Systematic / IUPAC Name: (2S,3S,4S,5R,6R)-3,4,5-Trihydroxy-6-[[(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]oxane-2-carboxylic acid
ID: Reference7341
Other Names:
3-Oxoestra-4-ene-17β-yl β-D-glucuronide;
(17β)-3-Oxoestr-4-en-17-yl β-D-glucopyranosiduronic acid
Formula: C24H34O8
Class: Therapeutics/Prescription Drugs Sports Doping Drugs Steroids/Vitamins/Hormones
Nandrolone glucuronide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 206 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/6/2018 8:46:33 AM |
| InChI | InChI=1S/C24H34O8/c1-24-9-8-14-13-5-3-12(25)10-11(13)2-4-15(14)16(24)6-7-17(24)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h10,13-21,23,26-28H,2-9H2,1H3,(H,29,30)/t13-,14+,15+,16-,17-,18-,19-,20+,21-,23+,24-/m0/s1 |
| InChI Key | ISBYSZZUCBXGIH-BWMLPLRISA-N |
| Canonical SMILES | CC12CCC3C(C1CCC2OC4C(C(C(C(O4)C(=O)O)O)O)O)CCC5=CC(=O)CCC35 |
| CAS | |
| Splash | |
| Other Names |
3-Oxoestra-4-ene-17β-yl β-D-glucuronide; (17β)-3-Oxoestr-4-en-17-yl β-D-glucopyranosiduronic acid |
| PubChem | 20598907 |