Systematic / IUPAC Name: Dimethyl 2,6-naphthalenedicarboxylate
ID: Reference7347
Other Names:
2,6-Dicarbomethoxynaphthalene;
2,6-Naphthalenedicarboxylic acid dimethyl ester;
Dimethyl ester of 2,6-naphthalenedicarboxylic acid;
Dimethylnaphthalene-2,6-dicarboxylate;
Methyl 6-(methoxycarbonyl)naphthalene-2-carboxylate
Formula: C14H12O4
Class: Extractables/Leachables
Dimethyl 2,6-naphthalenedicarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1874 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 11:08:29 AM |
| InChI | InChI=1S/C14H12O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-8H,1-2H3 |
| InChI Key | GYUVMLBYMPKZAZ-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)C(=O)OC |
| CAS | 840653 |
| Splash | |
| Other Names |
2,6-Dicarbomethoxynaphthalene; 2,6-Naphthalenedicarboxylic acid dimethyl ester; Dimethyl ester of 2,6-naphthalenedicarboxylic acid; Dimethylnaphthalene-2,6-dicarboxylate; Methyl 6-(methoxycarbonyl)naphthalene-2-carboxylate; Naphthalene-2,6-dicarboxylic acid dimethyl ester |
| PubChem | 61225 |
| ChEMBL | CHEMBL3188234 |
| ChemSpider | 55167 |
| ChemIDPlus | 000840653 |