Systematic / IUPAC Name: (1R,3R,5S,8S,9R,12S,13R,14S)-1-Hydroxy-14-(2-hydroxy-2-propanyl)-13-methyl-4,7,10-trioxapentacyclo[6.4.1.19,12 03,5 05,13]tetradecane-6,11-dione
ID: Reference7364
Other Names: (5S,8S,12S,14S,1R,3R,9R,13R)-1-Hydroxy-14-(1-hydroxy-isopropyl)-13-methyl-4,7, 10-trioxapentacyclo[6.4.1.1.0.0]tetradecane-6,11-dione
Formula: C15H18O7
Class: Endogenous Metabolites Natural Toxins
Picrotin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 280 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2018 11:11:23 AM |
| InChI | InChI=1S/C15H18O7/c1-12(2,18)6-7-10(16)20-8(6)9-13(3)14(7,19)4-5-15(13,22-5)11(17)21-9/h5-9,18-19H,4H2,1-3H3/t5-,6+,7-,8-,9-,13-,14-,15+/m1/s1 |
| InChI Key | RYEFFICCPKWYML-QCGISDTRSA-N |
| Canonical SMILES | CC12C3C4C(C(C1(CC5C2(O5)C(=O)O3)O)C(=O)O4)C(C)(C)O |
| CAS | |
| Splash | |
| Other Names | (5S,8S,12S,14S,1R,3R,9R,13R)-1-Hydroxy-14-(1-hydroxy-isopropyl)-13-methyl-4,7, 10-trioxapentacyclo[6.4.1.1.0.0]tetradecane-6,11-dione |
| ChEBI | CHEBI:8205 |
| KEGG | C09528 |
| PubChem | 442291 |
| Wikipedia | Picrotoxin |
| ChemSpider | 390759 |
| ChEMBL | CHEMBL478523 |