Systematic / IUPAC Name: 1,5-Diisocyanatonaphthalene
ID: Reference7385
Other Names:
Isocyanic acid, 1,5-naphthylene ester;
1,5-Naphthalene diisocyanate;
1,5-Naphthyl diisocyanate;
1,5-Naphthylene diisocyanate;
Naphthalene, 1,5-diisocyanato-
Formula: C12H6N2O2
Class: Extractables/Leachables
1,5-Diisocyanatonaphthalene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:11:41 AM |
| InChI | InChI=1S/C12H6N2O2/c15-7-13-11-5-1-3-9-10(11)4-2-6-12(9)14-8-16/h1-6H |
| InChI Key | SBJCUZQNHOLYMD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C=CC=C2N=C=O)C(=C1)N=C=O |
| CAS | 3173726 |
| Splash | |
| Other Names |
Isocyanic acid, 1,5-naphthylene ester; 1,5-Naphthalene diisocyanate; 1,5-Naphthyl diisocyanate; 1,5-Naphthylene diisocyanate; Naphthalene, 1,5-diisocyanato-; Naphthalene-1,5-diisocyanate |
| ChemSpider | 17476 |
| PubChem | 18503 |
| ChEBI | CHEBI:82496 |
| KEGG | C19464 |
| ChemIDPlus | 003173726 |