Systematic / IUPAC Name: 2-[4-({-[(4-Hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-2-yl}-2-methoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol
ID: Reference7389
Other Names:
Formula: C26H34O11
Lariciresinol 4-O-glucoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 3 |
| No. of Spectra | 3546 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/12/2018 3:03:34 PM |
| InChI | InChI=1S/C26H34O11/c1-33-19-8-13(3-5-17(19)29)7-15-12-35-25(16(15)10-27)14-4-6-18(20(9-14)34-2)36-26-24(32)23(31)22(30)21(11-28)37-26/h3-6,8-9,15-16,21-32H,7,10-12H2,1-2H3 |
| InChI Key | KNFOHFRALRKTOJ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=CC(=C1)CC2COC(C2CO)C3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)O |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 45027869 |