Systematic / IUPAC Name: 6-Hydroxynaphthalene-2-carboxylic acid
ID: Reference7415
Other Names:
6-Carboxy-2-naphthol;
2-Hydroxy-6-naphthoic acid;
2-Hydroxynaphthalene-6-carboxylic acid;
2-Naphthalenecarboxylic acid, 6-hydroxy-;
2-Naphthoic acid, 6-hydroxy-
; more
Formula: C11H8O3
Class: Extractables/Leachables
6-Hydroxy-2-naphthoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 273 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:27:20 AM |
| InChI | InChI=1S/C11H8O3/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6,12H,(H,13,14) |
| InChI Key | KAUQJMHLAFIZDU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C=CC(=C2)O)C=C1C(=O)O |
| CAS | 16712644 |
| Splash | |
| Other Names |
6-Carboxy-2-naphthol; 2-Hydroxy-6-naphthoic acid; 2-Hydroxynaphthalene-6-carboxylic acid; 2-Naphthalenecarboxylic acid, 6-hydroxy-; 2-Naphthoic acid, 6-hydroxy-; 2-Naphthol-6-carboxylic acid; 2-Napthalenecarboxylic acid, 6-hydroxy-; 6-Hydroxy-β-naphthoic acid; 6-Hydroxy-2-naphthalenecarboxylic acid; 6-Hydroxy-2-naphtoic acid; 6-Hydroxy-2-napthoic acid; 6-Hydroxy-naphthalene-2-carboxylic acid |
| PubChem | 85557 |
| ChemSpider | 77161 |
| ChEMBL | CHEMBL278950 |
| ChemIDPlus | 016712644 |