Systematic / IUPAC Name: [1-(5-Hydroxypentyl)indazol-3-yl]-naphthalen-1-ylmethanone
ID: Reference7489
Other Names: [1-(5-hydroxypentyl)-1H-indazol-3-yl]-1-naphthalenyl-methanone
Formula: C23H22N2O2
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs
THJ2201 N-(5-hydroxypentyl) metabolite mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2018 12:06:32 PM |
| InChI | InChI=1S/C23H22N2O2/c26-16-7-1-6-15-25-21-14-5-4-12-20(21)22(24-25)23(27)19-13-8-10-17-9-2-3-11-18(17)19/h2-5,8-14,26H,1,6-7,15-16H2 |
| InChI Key | YBDCPWAZXZXQGE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C3=NN(C4=CC=CC=C43)CCCCCO |
| CAS | 1850409163 |
| Splash | |
| Other Names | [1-(5-hydroxypentyl)-1H-indazol-3-yl]-1-naphthalenyl-methanone |
| PubChem | 129597845 |