Systematic / IUPAC Name: 1-(1-Phenylcyclohexyl)piperidin-4-ol
ID: Reference7493
Other Names:
1-(1-Phenylcyclohexyl)-4-piperidinol;
1-(1-Phenyl-cyclohexyl)-piperidin-4-ol;
4-Hydroxy phencyclidine;
4-Piperidinol, 1-(1-phenylcyclohexyl)-;
4-Piperidinol, 1[(1-phenyl)-1-cyclohexyl]-
; more
Formula: C17H25NO
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs Endogenous Metabolites
1-(1-Phenylcyclohexyl)-4-hydroxypiperidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2018 11:25:35 AM |
| InChI | InChI=1S/C17H25NO/c19-16-9-13-18(14-10-16)17(11-5-2-6-12-17)15-7-3-1-4-8-15/h1,3-4,7-8,16,19H,2,5-6,9-14H2 |
| InChI Key | SLUMSLWGPLFKGY-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)(C2=CC=CC=C2)N3CCC(CC3)O |
| CAS | 60232851 |
| Splash | |
| Other Names |
1-(1-Phenylcyclohexyl)-4-piperidinol; 1-(1-Phenyl-cyclohexyl)-piperidin-4-ol; 4-Hydroxy phencyclidine; 4-Piperidinol, 1-(1-phenylcyclohexyl)-; 4-Piperidinol, 1[(1-phenyl)-1-cyclohexyl]-; Phencyclidine-4-hydroxy analog; Piperidine, 1-(1-phenylcyclohexyl)-4-hydroxy; PCHP ; PHP |
| Wikipedia | PCHP |
| ChemSpider | 89272 |
| PubChem | 98840 |
| ChemIDPlus | 060232851 |
| ChEMBL | CHEMBL422629 |