Systematic / IUPAC Name: N-Phenyl-N-[1-(1-phenylpropan-2-yl)piperidin-4-yl]acetamide
ID: Reference7504
Other Names:
N-[1-(1-Methyl-2-phenethyl)-4-piperidinyl]-N-phenylacetamide ;
N-[1-(1-Methyl-2-phenylethyl)-4-piperidyl]acetanilide;
Acetamide, N-[1-(1-methyl-2-phenylethyl)-4-piperidinyl]-N-phenyl- ;
Acetyl-α-methyl fentanyl
Formula: C22H28N2O
α-Methylacetylfentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2018 1:23:15 PM |
| InChI | InChI=1S/C22H28N2O/c1-18(17-20-9-5-3-6-10-20)23-15-13-22(14-16-23)24(19(2)25)21-11-7-4-8-12-21/h3-12,18,22H,13-17H2,1-2H3 |
| InChI Key | OKTLVZBUKMRPLL-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC1=CC=CC=C1)N2CCC(CC2)N(C3=CC=CC=C3)C(=O)C |
| CAS | |
| Splash | |
| Other Names |
N-[1-(1-Methyl-2-phenethyl)-4-piperidinyl]-N-phenylacetamide ; N-[1-(1-Methyl-2-phenylethyl)-4-piperidyl]acetanilide; Acetamide, N-[1-(1-methyl-2-phenylethyl)-4-piperidinyl]-N-phenyl- ; Acetyl-α-methyl fentanyl |
| Wikipedia | Alphamethylacetylfentanyl |
| ChemSpider | 56102 |
| DrugBank | DB01532 |
| PubChem | 62307 |
| ChemIDPlus | 101860008 |