Systematic / IUPAC Name: (2S,3S)-3,5,7-Trihydroxy-6-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydro-4H-chromen-4-one
ID: Reference7505
Other Names: 4H-1-Benzopyran-4-one, 2,3-dihydro-3,5,7-trihydroxy-6-methyl-2-(3,4,5-trihydroxyphenyl)-, (2S,3S)-
Formula: C16H14O8
(2S,3S)-3,5,7-Trihydroxy-6-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydro-4H-chromen-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/9/2018 1:18:14 PM |
| InChI | InChI=1S/C16H14O8/c1-5-7(17)4-10-11(12(5)20)14(22)15(23)16(24-10)6-2-8(18)13(21)9(19)3-6/h2-4,15-21,23H,1H3/t15-,16+/m1/s1 |
| InChI Key | NZRLODDQFPZTPM-CVEARBPZSA-N |
| Canonical SMILES | CC1=C(C=C2C(=C1O)C(=O)C(C(O2)C3=CC(=C(C(=C3)O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names | 4H-1-Benzopyran-4-one, 2,3-dihydro-3,5,7-trihydroxy-6-methyl-2-(3,4,5-trihydroxyphenyl)-, (2S,3S)- |