Systematic / IUPAC Name: 2-[[2-Amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoic acid
ID: Reference751
Other Names:
Alanine, tyrosyl-;
Tyr-Ala
Formula: C12H16N2O4
Class: Endogenous Metabolites
Tyrosylalanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 258 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2015 10:22:26 AM |
| InChI | InChI=1S/C12H16N2O4/c1-7(12(17)18)14-11(16)10(13)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18) |
| InChI Key | NLKUJNGEGZDXGO-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)O)NC(=O)C(CC1=CC=C(C=C1)O)N |
| CAS | 821776083 |
| Splash | |
| Other Names |
Alanine, tyrosyl-; Tyr-Ala |