Systematic / IUPAC Name: (7E,13E)-9,15-Dihydroxy-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione
ID: Reference7542
Other Names:
Macrosphelide D;
1,5,11-Trioxacyclohexadeca-7,13-diene-2,6,12-trione, 9,15-dihydroxy-4,10,16-trimethyl-, (7E,13E)-
Formula: C16H22O8
(7E,13E)-9,15-Dihydroxy-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 87 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/14/2018 12:15:30 PM |
| InChI | InChI=1S/C16H22O8/c1-9-8-16(21)24-11(3)13(18)5-7-15(20)23-10(2)12(17)4-6-14(19)22-9/h4-7,9-13,17-18H,8H2,1-3H3/b6-4+,7-5+ |
| InChI Key | MJMMUATWVTYSFD-YDFGWWAZSA-N |
| Canonical SMILES | CC1CC(=O)OC(C(C=CC(=O)OC(C(C=CC(=O)O1)O)C)O)C |
| CAS | |
| Splash | |
| Other Names |
Macrosphelide D; 1,5,11-Trioxacyclohexadeca-7,13-diene-2,6,12-trione, 9,15-dihydroxy-4,10,16-trimethyl-, (7E,13E)- |