Systematic / IUPAC Name: (1S,4R)-4-{[(2S,9S,9aS)-9-Hydroxy-2-methyl-3-oxo-2,3,9,9a-tetrahydro-1H-imidazo[1,2-a]indol-9-yl]methyl}-1-methyl-2H-pyrazino[2,1-b]quinazoline-3,6(1H,4H)-dione
ID: Reference7584
Other Names: FQA
Formula: C24H23N5O4
Fumiquinazoline A mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/20/2018 8:10:20 AM |
| InChI | InChI=1S/C24H23N5O4/c1-12-19-27-16-9-5-3-7-14(16)22(32)28(19)18(20(30)25-12)11-24(33)15-8-4-6-10-17(15)29-21(31)13(2)26-23(24)29/h3-10,12-13,18,23,26,33H,11H2,1-2H3,(H,25,30)/t12-,13-,18+,23-,24-/m0/s1 |
| InChI Key | DQQCCKFZJNINST-VCPZKGNQSA-N |
| Canonical SMILES | CC1C2=NC3=CC=CC=C3C(=O)N2C(C(=O)N1)CC4(C5NC(C(=O)N5C6=CC=CC=C64)C)O |
| CAS | |
| Splash | |
| Other Names | FQA |
| PubChem | 11247802 |
| ChemSpider | 9422835 |
| ChEMBL | CHEMBL2229120 |
| Wikipedia | Fumiquinazoline |
| ChEBI | CHEBI:64546 |