Systematic / IUPAC Name: 5-{5-[(3,5-Dimethyl-1-piperazinyl)acetyl]-2-ethoxyphenyl}-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one
ID: Reference759
Other Names: 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 5-{5-[2-(3,5-dimethyl-1-piperazinyl)acetyl]-2-ethoxyphenyl}-1,6-dihydro-1-methyl-3-propyl-
Formula: C25H34N6O3
Class: Therapeutics/Prescription Drugs Counterfeit Drug (Therapeutic) Illegal Additives
Dimethylacetildenafil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 194 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/12/2016 11:03:27 AM |
| InChI | InChI=1S/C25H34N6O3/c1-6-8-19-22-23(30(5)29-19)25(33)28-24(27-22)18-11-17(9-10-21(18)34-7-2)20(32)14-31-12-15(3)26-16(4)13-31/h9-11,15-16,26H,6-8,12-14H2,1-5H3,(H,27,28,33) |
| InChI Key | YMCRGTBWSIWENP-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 5-{5-[2-(3,5-dimethyl-1-piperazinyl)acetyl]-2-ethoxyphenyl}-1,6-dihydro-1-methyl-3-propyl- |
| ChemSpider | 48057685 |