Systematic / IUPAC Name: {3-[(E)-2-(1,3-Benzodioxol-5-yl)vinyl]-2-oxiranyl}(1-piperidinyl)methanone
ID: Reference7622
Other Names: 1-{3-[(E)-2-(2H-1,3-Benzodioxol-5-yl)ethenyl]oxirane-2-carbonyl}piperidine
Formula: C17H19NO4
{3-[(E)-2-(1,3-Benzodioxol-5-yl)vinyl]-2-oxiranyl}(1-piperidinyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1406 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2018 6:17:36 AM |
| InChI | InChI=1S/C17H19NO4/c19-17(18-8-2-1-3-9-18)16-14(22-16)7-5-12-4-6-13-15(10-12)21-11-20-13/h4-7,10,14,16H,1-3,8-9,11H2/b7-5+ |
| InChI Key | VOXQNTWMJFAWIA-FNORWQNLSA-N |
| Canonical SMILES | C1CCN(CC1)C(=O)C2C(O2)C=CC3=CC4=C(C=C3)OCO4 |
| CAS | |
| Splash | |
| Other Names | 1-{3-[(E)-2-(2H-1,3-Benzodioxol-5-yl)ethenyl]oxirane-2-carbonyl}piperidine |