Systematic / IUPAC Name: 4-Acetamido-5-[2-(4-hydroxyphenyl)ethylamino]-5-oxopentanoic acid
ID: Reference7626
Other Names:
Formula: C15H20N2O5
4-Acetamido-5-[2-(4-hydroxyphenyl)ethylamino]-5-oxopentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1355 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2018 7:06:33 AM |
| InChI | InChI=1S/C15H20N2O5/c1-10(18)17-13(6-7-14(20)21)15(22)16-9-8-11-2-4-12(19)5-3-11/h2-5,13,19H,6-9H2,1H3,(H,16,22)(H,17,18)(H,20,21) |
| InChI Key | QKTVHZCBVNESSR-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC(CCC(=O)O)C(=O)NCCC1=CC=C(C=C1)O |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 75528942 |