Systematic / IUPAC Name: (6aS)-1,2,11-Trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10-ol
ID: Reference7629
Other Names: 3,15,16-trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,13,15-hexaen-4-ol
Formula: C19H21NO4
Hernagine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2018 8:12:02 AM |
| InChI | InChI=1S/C19H21NO4/c1-22-14-9-11-6-7-20-12-8-10-4-5-13(21)18(23-2)16(10)17(15(11)12)19(14)24-3/h4-5,9,12,20-21H,6-8H2,1-3H3/t12-/m0/s1 |
| InChI Key | MULATNABYLUECQ-LBPRGKRZSA-N |
| Canonical SMILES | COC1=C(C2=C3C(CC4=C2C(=C(C=C4)O)OC)NCCC3=C1)OC |
| CAS | |
| Splash | |
| Other Names | 3,15,16-trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,13,15-hexaen-4-ol |
| PubChem | 26212854 |