Systematic / IUPAC Name: 3-{3-[(2E)-3,7-Dimethylocta-2,6-dienyl]-4-hydroxyphenyl}-7-hydroxychromen-4-one
ID: Reference7645
Other Names:
Corylifol A;
3-{3-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-4-hydroxyphenyl}-7-hydroxy-4H-1-benzopyran-4-one ;
4H-1-Benzopyran-4-one, 3-{3-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-4-hydroxyphenyl}-7-hydroxy-
Formula: C25H26O4
3-{3-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-4-hydroxyphenyl}-7-hydroxy-4H-chromen-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/27/2018 9:08:27 AM |
| InChI | InChI=1S/C25H26O4/c1-16(2)5-4-6-17(3)7-8-19-13-18(9-12-23(19)27)22-15-29-24-14-20(26)10-11-21(24)25(22)28/h5,7,9-15,26-27H,4,6,8H2,1-3H3/b17-7+ |
| InChI Key | ZBHUUXLHDOUMKM-REZTVBANSA-N |
| Canonical SMILES | CC(=CCCC(=CCC1=C(C=CC(=C1)C2=COC3=C(C2=O)C=CC(=C3)O)O)C)C |
| CAS | |
| Splash | |
| Other Names |
Corylifol A; 3-{3-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-4-hydroxyphenyl}-7-hydroxy-4H-1-benzopyran-4-one ; 4H-1-Benzopyran-4-one, 3-{3-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-4-hydroxyphenyl}-7-hydroxy- |