Systematic / IUPAC Name: 3-(1-hydroxyethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
ID: Reference7669
Other Names:
Formula: C9H14N2O3
3-(1-hydroxyethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/29/2018 12:19:20 PM |
| InChI | InChI=1S/C9H14N2O3/c1-5(12)7-9(14)11-4-2-3-6(11)8(13)10-7/h5-7,12H,2-4H2,1H3,(H,10,13) |
| InChI Key | UBLWFFBGMBRBMC-UHFFFAOYSA-N |
| Canonical SMILES | CC(C1C(=O)N2CCCC2C(=O)N1)O |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 73146465 |