Systematic / IUPAC Name: 3,4,5-Trihydroxy-6-(1H-indol-3-yloxy)oxane-2-carboxylic acid
ID: Reference767
Other Names:
(2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-(1H-indol-3-yloxy)oxane-2-carboxylic acid;
Indoxyl glucuronide;
3-Indolyl-β-D-glucuronide;
β-D-Glucopyranosiduronic acid, 1H-indol-3-yl
Formula: C14H15NO7
Class: Endogenous Metabolites
Indoxyl-β-D-glucuronide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 97 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2015 9:29:24 AM |
| InChI | InChI=1S/C14H15NO7/c16-9-10(17)12(13(19)20)22-14(11(9)18)21-8-5-15-7-4-2-1-3-6(7)8/h1-5,9-12,14-18H,(H,19,20)/t9-,10-,11+,12-,14+/m0/s1 |
| InChI Key | KUYNOZVWCFXSNE-BYNIDDHOSA-N |
| Canonical SMILES | |
| CAS | 149231458 |
| Splash | |
| Other Names |
(2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-(1H-indol-3-yloxy)oxane-2-carboxylic acid; Indoxyl glucuronide; 3-Indolyl-β-D-glucuronide; β-D-Glucopyranosiduronic acid, 1H-indol-3-yl |