Systematic / IUPAC Name: 3,7-dihydroxy-14-methoxy-17-methyl-12,16,21-trioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2,4(13),6,8,10,14-hexaen-5-one
ID: Reference7670
Other Names:
Formula: C20H18O7
3,7-dihydroxy-14-methoxy-17-methyl-12,16,21-trioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2,4(13),6,8,10,14-hexaen-5-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/29/2018 12:27:13 PM |
| InChI | InChI=1S/C20H18O7/c1-20-8-4-7-11(26-20)13-16(23)14-15(22)12-9(21)5-3-6-10(12)25-17(14)19(24-2)18(13)27-20/h3,5-6,11,21,23H,4,7-8H2,1-2H3 |
| InChI Key | WHXAHEFPHFIHPO-UHFFFAOYSA-N |
| Canonical SMILES | c1cc(c2c(c1)oc1c(c2=O)c(c2c(c1OC)OC1(OC2CCC1)C)O)O |
| CAS | |
| Splash | |
| Other Names |