Systematic / IUPAC Name: 3-hydroxy-3-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl)oxycarbonyl]pentanedioic acid
ID: Reference7676
Other Names:
Formula: C16H24O7
3-hydroxy-3-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl)oxycarbonyl]pentanedioic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 285 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/3/2018 10:03:06 AM |
| InChI | InChI=1S/C16H24O7/c1-14(2)9-4-5-15(14,3)10(6-9)23-13(21)16(22,7-11(17)18)8-12(19)20/h9-10,22H,4-8H2,1-3H3,(H,17,18)(H,19,20) |
| InChI Key | OAWJOZQLMVETKE-UHFFFAOYSA-N |
| Canonical SMILES | CC1(C2CCC1(C(C2)OC(=O)C(CC(=O)O)(CC(=O)O)O)C)C |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 75528876 |