Systematic / IUPAC Name: 5-[2-(4-Allyl-2-methoxyphenoxy)propyl]-1,2,3-trimethoxybenzene
ID: Reference7713
Other Names: Benzene, 1,2,3-trimethoxy-5-[2-[2-methoxy-4-(2-propen-1-yl)phenoxy]propyl]-
Formula: C22H28O5
5-[2-(4-Allyl-2-methoxyphenoxy)propyl]-1,2,3-trimethoxybenzene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/5/2018 2:08:58 PM |
| InChI | InChI=1S/C22H28O5/c1-7-8-16-9-10-18(19(12-16)23-3)27-15(2)11-17-13-20(24-4)22(26-6)21(14-17)25-5/h7,9-10,12-15H,1,8,11H2,2-6H3 |
| InChI Key | KKYNVNUZEODDKF-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC1=CC(=C(C(=C1)OC)OC)OC)OC2=C(C=C(C=C2)CC=C)OC |
| CAS | |
| Splash | |
| Other Names | Benzene, 1,2,3-trimethoxy-5-[2-[2-methoxy-4-(2-propen-1-yl)phenoxy]propyl]- |