Systematic / IUPAC Name: 2,17'-Dimethyl-1,2,3,9a-tetrahydro-13'-oxa-2',10',17'-triazaspiro{imidazo[1,2-a]indole-9,14'-tetracyclo[10.3.2.02,11.04,9]heptadecane}-4',6',8',10'-tetraene-3,3',16'-trione
ID: Reference7723
Other Names:
Formula: C24H21N5O4
2,17'-Dimethyl-1,2,3,9a-tetrahydro-13'-oxa-2',10',17'-triazaspiro{imidazo[1,2-a]indole-9,14'-tetracyclo[10.3.2.02,11.04,9]heptadecane}-4',6',8',10'-tetraene-3,3',16'-trione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/9/2018 7:43:12 AM |
| InChI | InChI=1S/C24H21N5O4/c1-12-19(30)29-16-10-6-4-8-14(16)24(23(29)25-12)11-17-21(32)27(2)22(33-24)18-26-15-9-5-3-7-13(15)20(31)28(17)18/h3-10,12,17,22-23,25H,11H2,1-2H3 |
| InChI Key | BOZGEGDMHAOPIQ-UHFFFAOYSA-N |
| Canonical SMILES | c1ccc2c(c1)nc1n(c2=O)C2C(=O)N(C1OC1(C2)C2N(c3c1cccc3)C(=O)C(N2)C)C |
| CAS | |
| Splash | |
| Other Names |