Systematic / IUPAC Name: 1,7-Bis(4-hydroxyphenyl)heptane-3,5-diol
ID: Reference7757
Other Names: 3,5-Heptanediol, 1,7-bis(4-hydroxyphenyl)-
Formula: C19H24O4
1,7-Bis(4-hydroxyphenyl)-3,5-heptanediol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/11/2018 12:53:52 PM |
| InChI | InChI=1S/C19H24O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-4,7-10,18-23H,5-6,11-13H2 |
| InChI Key | GZVIQGVWSNEONZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1CCC(CC(CCC2=CC=C(C=C2)O)O)O)O |
| CAS | |
| Splash | |
| Other Names | 3,5-Heptanediol, 1,7-bis(4-hydroxyphenyl)- |