Systematic / IUPAC Name: (3S)-5-[(4aR,8aS)-2,5,5,8a-Tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]-3-methylpentanoic acid
ID: Reference7758
Other Names:
Formula: C20H32O3
(3S)-5-[(4aR,8aS)-2,5,5,8a-Tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]-3-methylpentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/11/2018 1:38:34 PM |
| InChI | InChI=1S/C20H32O3/c1-13(11-18(22)23)7-8-15-14(2)16(21)12-17-19(3,4)9-6-10-20(15,17)5/h13,17H,6-12H2,1-5H3,(H,22,23)/t13-,17+,20+/m0/s1 |
| InChI Key | BARZJLALPXZLMN-WSXQUGQNSA-N |
| Canonical SMILES | CC1=C(C2(CCCC(C2CC1=O)(C)C)C)CCC(C)CC(=O)O |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 26183531 |