Systematic / IUPAC Name: 12-Hydroxy-10-(hydroxymethyl)-6-methyl-2-(4-methyl-3-penten-1-yl)-2,6,10-dodecatrienoic acid
ID: Reference7788
Other Names: 2,6,10-Dodecatrienoic acid, 12-hydroxy-10-(hydroxymethyl)-6-methyl-2-(4-methyl-3-penten-1-yl)-
Formula: C20H32O4
12-Hydroxy-10-(hydroxymethyl)-6-methyl-2-(4-methyl-3-penten-1-yl)-2,6,10-dodecatrienoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 156 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2018 1:02:54 PM |
| InChI | InChI=1S/C20H32O4/c1-16(2)7-4-11-19(20(23)24)12-6-9-17(3)8-5-10-18(15-22)13-14-21/h7-8,12-13,21-22H,4-6,9-11,14-15H2,1-3H3,(H,23,24)/b17-8+,18-13-,19-12+ |
| InChI Key | GWVCYAYKRPLWGK-AAMZJHKISA-N |
| Canonical SMILES | CC(=CCCC(=CCCC(=CCCC(=CCO)CO)C)C(=O)O)C |
| CAS | |
| Splash | |
| Other Names | 2,6,10-Dodecatrienoic acid, 12-hydroxy-10-(hydroxymethyl)-6-methyl-2-(4-methyl-3-penten-1-yl)- |