Systematic / IUPAC Name: 2-[(2'R,4aS,8R,8aS)-2',4,4,7,8a-Pentamethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid
ID: Reference7809
Other Names:
Formula: C20H32O3
13-Isogrindelic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 639 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/19/2018 11:38:33 AM |
| InChI | InChI=1S/C20H32O3/c1-14-7-8-15-17(2,3)9-6-10-19(15,5)20(14)12-11-18(4,23-20)13-16(21)22/h7,15H,6,8-13H2,1-5H3,(H,21,22)/t15-,18+,19-,20+/m0/s1 |
| InChI Key | XLWWERNKTLITEF-JOCLIGHLSA-N |
| Canonical SMILES | CC1=CCC2C(CCCC2(C13CCC(O3)(C)CC(=O)O)C)(C)C |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 15559587 |