Systematic / IUPAC Name: (E)-1,7-Bis(4-hydroxyphenyl)hept-4-en-3-one
ID: Reference7849
Other Names:
Platyphyllenone;
(4E)-1,7-Bis(4-hydroxyphenyl)hept-4-en-3-one;
4-Hepten-3-one, 1,7-bis(4-hydroxyphenyl)-, (4E)-
Formula: C19H20O3
(4E)-1,7-Bis(4-hydroxyphenyl)-4-hepten-3-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 3 |
| No. of Spectra | 2914 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/24/2018 12:04:22 PM |
| InChI | InChI=1S/C19H20O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h2,4-6,8-9,11-14,21-22H,1,3,7,10H2/b4-2+ |
| InChI Key | GIKJADRKBZHVCY-DUXPYHPUSA-N |
| Canonical SMILES | C1=CC(=CC=C1CCC=CC(=O)CCC2=CC=C(C=C2)O)O |
| CAS | |
| Splash | |
| Other Names |
Platyphyllenone; (4E)-1,7-Bis(4-hydroxyphenyl)hept-4-en-3-one; 4-Hepten-3-one, 1,7-bis(4-hydroxyphenyl)-, (4E)- |
| ChemSpider | 22912888 |
| ChEMBL | CHEMBL330645 |
| PubChem | 23786382 |