Systematic / IUPAC Name: (6S)-6-[2-(1,3-Benzodioxol-5-yl)ethyl]-4-methoxy-5,6-dihydro-2H-pyran-2-one
ID: Reference7883
Other Names:
(+)-Dihydromethysticin;
7,8-Dihydromethysticin;
Methysticin, 7,8-dihydro-;
(2S)-2-[2-(1,3-Benzodioxol-5-yl)ethyl]-4-methoxy-2,3-dihydropyran-6-one;
2H-Pyran-2-one, 5,6-dihydro-4-methoxy-6-[3,4-(methylenedioxy)phenethyl]-, (S)-
Formula: C15H16O5
Dihydromethysticin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1894 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/2/2018 12:06:33 PM |
| InChI | InChI=1S/C15H16O5/c1-17-12-7-11(20-15(16)8-12)4-2-10-3-5-13-14(6-10)19-9-18-13/h3,5-6,8,11H,2,4,7,9H2,1H3/t11-/m0/s1 |
| InChI Key | RSIWXFIBHXYNFM-NSHDSACASA-N |
| Canonical SMILES | COC1=CC(=O)OC(C1)CCC2=CC3=C(C=C2)OCO3 |
| CAS | 19902911 |
| Splash | |
| Other Names |
(+)-Dihydromethysticin; 7,8-Dihydromethysticin; Methysticin, 7,8-dihydro-; (2S)-2-[2-(1,3-Benzodioxol-5-yl)ethyl]-4-methoxy-2,3-dihydropyran-6-one; 2H-Pyran-2-one, 5,6-dihydro-4-methoxy-6-[3,4-(methylenedioxy)phenethyl]-, (S)- ; 2H-Pyran-2-one, 6-[2-(1,3-benzodioxol-5-yl)ethyl]-5,6-dihydro-4-methoxy-, (S)- |
| KEGG | C09926 |
| ChEMBL | CHEMBL576066 |
| PubChem | 88308 |
| ChEBI | CHEBI:4573 |
| ChemIDPlus | 019902911 |
| ChemSpider | 79667 |