Systematic / IUPAC Name: (1S,12S,14R)-9-Methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,7]heptadeca-6,8,10(17),15-tetraen-14-ol
ID: Reference7886
Other Names:
Formula: C17H21NO3
(1S,12S,14R)-9-Methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,7]heptadeca-6,8,10(17),15-tetraen-14-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/2/2018 12:41:47 PM |
| InChI | InChI=1S/C17H21NO3/c1-18-6-5-17-4-3-12(19)8-15(17)21-14-9-13(20-2)7-11(10-18)16(14)17/h3-4,7,9,12,15,19H,5-6,8,10H2,1-2H3/t12-,15-,17-/m0/s1 |
| InChI Key | CBEUVCFNXNEQHY-NUTKFTJISA-N |
| Canonical SMILES | CN1CCC23C=CC(CC2OC4=C3C(=CC(=C4)OC)C1)O |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 44410327 |