Systematic / IUPAC Name: 1-Isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane
ID: Reference7892
            Other Names: 
                    Hylene W; 
                    Nacconate H 12; 
                    1,1'-Methylenebis(4-isocyanatocyclohexane); 
                    1,1-Methylenebis(4-isocyanatocyclohexane); 
                    4,4'-Diisocyanatodicyclohexylmethane
; more
        
Formula: C15H22N2O2
Class: Extractables/Leachables
4,4'-Diisocyanatodicyclohexylmethane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS | 
| No. of Spectral Trees | 1 | 
| No. of Spectra | 1398 | 
| Tandem Spectra | MS1, MS2, MS3 | 
| Ionization Methods | NSI | 
| Analyzers | FT | 
| Last Modification | 5/9/2018 8:18:55 AM | 
| InChI | InChI=1S/C15H22N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h12-15H,1-9H2 | 
| InChI Key | KORSJDCBLAPZEQ-UHFFFAOYSA-N | 
| Canonical SMILES | C1CC(CCC1CC2CCC(CC2)N=C=O)N=C=O | 
| CAS | 5124301 | 
| Splash | |
| Other Names | Hylene W; Nacconate H 12; 1,1'-Methylenebis(4-isocyanatocyclohexane); 1,1-Methylenebis(4-isocyanatocyclohexane); 4,4'-Diisocyanatodicyclohexylmethane; 4,4'-Methylenebis(cyclohexyl isocyanate); 4,4'-Methylenedi(cyclohexyl isocyanate); 4,4'-Methylenedicyclohexyl diisocyanate; Bis(4-isocyanatocyclohexyl)methane; Cyclohexane, 1,1'-methylenebis[4-isocyanato-; Dicyclohexylmethane 4,4'-diisocyanate; Isocyanic acid, methylenedi-4,1-cyclohexylene ester; Methylene bis(4-cyclohexylisocyanate) | 
| ChemIDPlus | 005124301; 013622907 | 
| ChEBI | CHEBI:53216 | 
| ChemSpider | 19934 | 
| PubChem | 21202 | 
| ChEMBL | CHEMBL1878565 |