Systematic / IUPAC Name: 2-[4-(4-Oxo-3,1-benzoxazin-2-yl)phenyl]-3,1-benzoxazin-4-one
ID: Reference7895
Other Names:
2,2-(1,4-Phenylene)bis((4H-3,1-benzoxazine-4-one);
2,2'-(1,4-Phenylene)bis(3,1-benzoxazin-4-one);
2,2'-(1,4-Phenylene)bis(4H-3,1-benzoxazin-4-one);
2,2'-(1,4-Phenylene)bis(4H-benzo[d][1,3]oxazin-4-one);
2,2-(1,4-Phenylene)bis-4H-3,1-benzoxazin-4-one
; more
Formula: C22H12N2O4
Class: Extractables/Leachables
2,2'-(1,4-Phenylene)bis(4H-3,1-benzoxazin-4-one) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 679 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/9/2018 8:32:06 AM |
| InChI | InChI=1S/C22H12N2O4/c25-21-15-5-1-3-7-17(15)23-19(27-21)13-9-11-14(12-10-13)20-24-18-8-4-2-6-16(18)22(26)28-20/h1-12H |
| InChI Key | BBITXNWQALLODC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)OC(=N2)C3=CC=C(C=C3)C4=NC5=CC=CC=C5C(=O)O4 |
| CAS | 18600594 |
| Splash | |
| Other Names |
2,2-(1,4-Phenylene)bis((4H-3,1-benzoxazine-4-one); 2,2'-(1,4-Phenylene)bis(3,1-benzoxazin-4-one); 2,2'-(1,4-Phenylene)bis(4H-3,1-benzoxazin-4-one); 2,2'-(1,4-Phenylene)bis(4H-benzo[d][1,3]oxazin-4-one); 2,2-(1,4-Phenylene)bis-4H-3,1-benzoxazin-4-one; 2,2'-Benzene-1,4-diylbis(4H-3,1-benzoxazin-4-one); 2-[4-(4-Oxobenzo[d]1,3-oxazin-2-yl)phenyl]benzo[d]1,3-oxazin-4-one; 4H-3,1-Benzoxazin-4-one, 2,2'-(1,4-phenylene)bis-; Phenylene-1,4-bis-(benz-1,3-oxazin-4-one) |