Systematic / IUPAC Name: 6-O-Acetyl-1,3,4-tri-O-isobutyryl-β-D-fructofuranosyl 6-O-acetyl-2,3,4-tri-O-isobutyryl-α-D-glucopyranoside
ID: Reference7898
Other Names:
Formula: C40H62O19
Class: Extractables/Leachables
Sucrose acetate isobutyrate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 315 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/9/2018 11:41:40 AM |
| InChI | InChI=1S/C40H62O19/c1-18(2)33(43)51-17-40(32(57-38(48)23(11)12)29(54-35(45)20(5)6)27(58-40)16-50-25(14)42)59-39-31(56-37(47)22(9)10)30(55-36(46)21(7)8)28(53-34(44)19(3)4)26(52-39)15-49-24(13)41/h18-23,26-32,39H,15-17H2,1-14H3/t26-,27-,28-,29-,30+,31-,32+,39-,40+/m1/s1 |
| InChI Key | ZNEBZIJCDDCNRC-SWTLDUCYSA-N |
| Canonical SMILES | CC(C)C(=O)OCC1(C(C(C(O1)COC(=O)C)OC(=O)C(C)C)OC(=O)C(C)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C |
| CAS | 126136 |
| Splash | |
| Other Names |
| ChemSpider | 2016849 |
| Wikipedia | Sucrose acetate isobutyrate |
| PubChem | 2735139 |