Systematic / IUPAC Name: 10-[2-(1-Methylpiperidin-2-yl)ethyl]-2-methylsulfinylphenothiazine
ID: Reference793
Other Names:
Thioridazine-2-sulfoxide;
Thioridazien thiomethyl sulfoxide;
10H-Phenothiazine, 10-[2-(1-methyl-2-piperidinyl)ethyl]-2-(methylsulfinyl)-;
10-[2-(1-Methylpiperidin-2-yl)ethyl]-2-(methylsulfinyl)-10H-phenothiazine;
Phenothiazine, 10-[2-(1-methyl-2-piperidyl)ethyl]-2-(methylsulfinyl)-
; more
Formula: C21H26N2OS2
Class: Therapeutics/Prescription Drugs
Mesoridazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 248 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 3/10/2015 10:33:08 AM |
| InChI | InChI=1S/C21H26N2OS2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
| InChI Key | SLVMESMUVMCQIY-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCCCC1CCN2C3=CC=CC=C3SC4=C2C=C(C=C4)S(=O)C |
| CAS | 5588330 |
| Splash | |
| Other Names |
Thioridazine-2-sulfoxide; Thioridazien thiomethyl sulfoxide; 10H-Phenothiazine, 10-[2-(1-methyl-2-piperidinyl)ethyl]-2-(methylsulfinyl)-; 10-[2-(1-Methylpiperidin-2-yl)ethyl]-2-(methylsulfinyl)-10H-phenothiazine; Phenothiazine, 10-[2-(1-methyl-2-piperidyl)ethyl]-2-(methylsulfinyl)-; Serentil; Calodal; Lidanar; Lidanil |
| ChemSpider | 3936 |
| Wikipedia | Mesoridazine |
| DrugBank | APRD00610 |
| ChEBI | CHEBI:6780 |
| KEGG | C07143; D00795; D02671 |
| ChemIDPlus | 007651436; 005588330; 032672698 |
| PubChem | 4078 |
| ChEMBL | CHEMBL1088 |