Systematic / IUPAC Name: 9-Phenyl-1-(2,4,6-trihydroxyphenyl)nonan-1-one
ID: Reference7933
Other Names: 1-Nonanone, 9-phenyl-1-(2,4,6-trihydroxyphenyl)-
Formula: C21H26O4
9-Phenyl-1-(2,4,6-trihydroxyphenyl)-1-nonanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/14/2018 7:56:02 AM |
| InChI | InChI=1S/C21H26O4/c22-17-14-19(24)21(20(25)15-17)18(23)13-9-4-2-1-3-6-10-16-11-7-5-8-12-16/h5,7-8,11-12,14-15,22,24-25H,1-4,6,9-10,13H2 |
| InChI Key | OOGZWXIAHJKVAH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CCCCCCCCC(=O)C2=C(C=C(C=C2O)O)O |
| CAS | |
| Splash | |
| Other Names | 1-Nonanone, 9-phenyl-1-(2,4,6-trihydroxyphenyl)- |