Systematic / IUPAC Name: 10-Methoxy-8,8-dimethyl-2H,8H-pyrano[3,2-g]chromen-2-one
ID: Reference7950
Other Names:
10-Methoxy-8,8-dimethyl-2H,8H-benzo[1,2-b:5,4-b']dipyran-2-one;
2H,8H-Benzo(1,2-b:5,4-b')dipyran-2-one, 10-methoxy-8,8-dimethyl-
Formula: C15H14O4
Luvangetin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/14/2018 3:24:15 PM |
| InChI | InChI=1S/C15H14O4/c1-15(2)7-6-10-8-9-4-5-11(16)18-12(9)14(17-3)13(10)19-15/h4-8H,1-3H3 |
| InChI Key | XYPWCJWXFYYGPA-UHFFFAOYSA-N |
| Canonical SMILES | CC1(C=CC2=C(O1)C(=C3C(=C2)C=CC(=O)O3)OC)C |
| CAS | |
| Splash | |
| Other Names |
10-Methoxy-8,8-dimethyl-2H,8H-benzo[1,2-b:5,4-b']dipyran-2-one; 2H,8H-Benzo(1,2-b:5,4-b')dipyran-2-one, 10-methoxy-8,8-dimethyl- |
| PubChem | 343582 |
| ChEMBL | CHEMBL254379 |
| ChemIDPlus | 000483921; 483921 |
| KEGG | C09273 |
| ChEBI | CHEBI:6586 |
| ChemSpider | 304587 |