Systematic / IUPAC Name: (2E)-3-(3,4-Dimethoxyphenyl)-1-(2,4,6-trimethoxyphenyl)-2-propen-1-one
ID: Reference7977
Other Names:
(E)-3-(3,4-Dimethoxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one;
(2E)-3-(3,4-Dimethoxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one;
2-Propen-1-one, 3-(3,4-dimethoxyphenyl)-1-(2,4,6-trimethoxyphenyl)-, (2E)-
Formula: C20H22O6
2',3,4,4',6'-Pentamethoxychalcone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/17/2018 9:04:49 AM |
| InChI | InChI=1S/C20H22O6/c1-22-14-11-18(25-4)20(19(12-14)26-5)15(21)8-6-13-7-9-16(23-2)17(10-13)24-3/h6-12H,1-5H3/b8-6+ |
| InChI Key | TVKGYMYAOVADOP-SOFGYWHQSA-N |
| Canonical SMILES | COC1=C(C=C(C=C1)C=CC(=O)C2=C(C=C(C=C2OC)OC)OC)OC |
| CAS | |
| Splash | |
| Other Names |
(E)-3-(3,4-Dimethoxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one; (2E)-3-(3,4-Dimethoxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one; 2-Propen-1-one, 3-(3,4-dimethoxyphenyl)-1-(2,4,6-trimethoxyphenyl)-, (2E)- |
| ChemSpider | 4508985 |
| ChEMBL | CHEMBL1719690; CHEMBL3416017 |
| PubChem | 5352007 |
| ChemIDPlus | 76650209 |