Systematic / IUPAC Name: [5-Acetyloxy-3-(hydroxymethyl)-2-oxo-6-propan-2-ylcyclohex-3-en-1-yl] 3-methylpentanoate
ID: Reference7989
Other Names: Pentanoic acid, 3-methyl-, 5-(acetyloxy)-3-(hydroxymethyl)-6-(1-methylethyl)-2-oxo-3-cyclohexen-1-yl ester
Formula: C18H28O6
5-Acetoxy-3-(hydroxymethyl)-6-isopropyl-2-oxo-3-cyclohexen-1-yl 3-methylpentanoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 264 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/22/2018 8:42:49 AM |
| InChI | InChI=1S/C18H28O6/c1-6-11(4)7-15(21)24-18-16(10(2)3)14(23-12(5)20)8-13(9-19)17(18)22/h8,10-11,14,16,18-19H,6-7,9H2,1-5H3 |
| InChI Key | MPXXSICHRNCHHK-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C)CC(=O)OC1C(C(C=C(C1=O)CO)OC(=O)C)C(C)C |
| CAS | |
| Splash | |
| Other Names | Pentanoic acid, 3-methyl-, 5-(acetyloxy)-3-(hydroxymethyl)-6-(1-methylethyl)-2-oxo-3-cyclohexen-1-yl ester |