Systematic / IUPAC Name: Methyl 4-hydroxybenzoate
ID: Reference800
Other Names:
Methyl paraben;
Benzoic acid, 4-hydroxy, methyl ester;
p-Hydroxybenzoic acid methyl ester;
4-Hydroxybenzoic acid methyl ester;
Methyl-p-hydroxybenzoate
; more
Formula: C8H8O3
Class: Endogenous Metabolites
Methylparaben mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 122 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2015 2:56:05 PM |
| InChI | InChI=1S/C8H8O3/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5,9H,1H3 |
| InChI Key | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=CC=C(C=C1)O |
| CAS | 99763 |
| Splash | |
| Other Names |
Methyl paraben; Benzoic acid, 4-hydroxy, methyl ester; p-Hydroxybenzoic acid methyl ester; 4-Hydroxybenzoic acid methyl ester; Methyl-p-hydroxybenzoate; p-Hydroxybenzoic methyl ester; Nipagin; Aseptoform; Maseptol; Metaben; Methaben; Metoxyde; Paridol; Preserval; Solbrol; Moldex; Septos; Abiol; Preserval M; Tegosept M; Nipagin M; Solbrol M; Tegosept |
| PubChem | 7456 |
| Wikipedia | Methylparaben |
| ChEMBL | CHEMBL325372 |
| ChEBI | CHEBI:31835 |
| ChemSpider | 7176 |
| ChemIDPlus | 000099763; 005026620; 026112072 |
| HMDb | HMDB32572 |
| KEGG | D01400; D02458 |