Systematic / IUPAC Name: (3α,4β,8α)-3,8-Dihydroxy-12,13-epoxytrichothec-9-ene-4,15-diyl diacetate
ID: Reference8028
Other Names:
Trichothec-9-ene, 12,13-epoxy-4-β,15-diacetoxy-3-α,8-α-dihydroxy-;
Trichothec-9-ene-3-α,4-β,8-α,15-tetrol, 12,13-epoxy-, 4,15-diacetate
Formula: C19H26O8
(3α,4β,8α)-3,8-Dihydroxy-12,13-epoxytrichothec-9-ene-4,15-diyl diacetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 453 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/5/2018 6:36:59 AM |
| InChI | InChI=1S/C19H26O8/c1-9-5-13-18(6-12(9)22,7-24-10(2)20)17(4)15(26-11(3)21)14(23)16(27-13)19(17)8-25-19/h5,12-16,22-23H,6-8H2,1-4H3/t12-,13+,14+,15+,16+,17+,18+,19-/m0/s1 |
| InChI Key | TVZHDVCTOCZDNE-WVJYZQHISA-N |
| Canonical SMILES | CC1=CC2C(CC1O)(C3(C(C(C(C34CO4)O2)O)OC(=O)C)C)COC(=O)C |
| CAS | |
| Splash | |
| Other Names |
Trichothec-9-ene, 12,13-epoxy-4-β,15-diacetoxy-3-α,8-α-dihydroxy-; Trichothec-9-ene-3-α,4-β,8-α,15-tetrol, 12,13-epoxy-, 4,15-diacetate |
| PubChem | 13818797 |
| ChEMBL | CHEMBL422680 |
| ChemSpider | 19970352 |