Systematic / IUPAC Name: (3S,4R)-3-(1-hydroxyhexyl)-4-(hydroxymethyl)oxolan-2-one
ID: Reference8029
Other Names:
Formula: C11H20O4
(3S,4R)-3-(1-hydroxyhexyl)-4-(hydroxymethyl)oxolan-2-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/5/2018 7:35:39 AM |
| InChI | InChI=1S/C11H20O4/c1-2-3-4-5-9(13)10-8(6-12)7-15-11(10)14/h8-10,12-13H,2-7H2,1H3/t8-,9?,10+/m1/s1 |
| InChI Key | ONFPUQOPHZOEKF-FIBVVXLUSA-N |
| Canonical SMILES | CCCCCC(C1C(COC1=O)CO)O |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 101601976 |