Systematic / IUPAC Name: (2S,3R,4S,5S,6R)-2-[4-(3-Hydroxybutyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
ID: Reference8067
Other Names: β-D-Glucopyranoside, 4-(3-hydroxybutyl)phenyl
Formula: C16H24O7
4-(3-Hydroxybutyl)phenyl β-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 609 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/13/2018 10:56:16 AM |
| InChI | InChI=1S/C16H24O7/c1-9(18)2-3-10-4-6-11(7-5-10)22-16-15(21)14(20)13(19)12(8-17)23-16/h4-7,9,12-21H,2-3,8H2,1H3/t9?,12-,13-,14+,15-,16-/m1/s1 |
| InChI Key | SCUSKAVTYFDOEU-YLHHEPAUSA-N |
| Canonical SMILES | CC(CCC1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O)O |
| CAS | |
| Splash | |
| Other Names | β-D-Glucopyranoside, 4-(3-hydroxybutyl)phenyl |