Systematic / IUPAC Name: 7-(Dimethylamino)-N,N-dimethyl-3H-phenothiazin-3-iminium
ID: Reference807
Other Names:
Methanaminium, N-[7-(dimethylamino)-3H-phenothiazin-3-ylidene]-N-methyl-;
3,7-Bis(dimethylamino)phenothiazin-5-ium;
3H-Phenothiazine, 7-(dimethylamino)-3-(methylimino), 3-methochloride;
Phenothiazin-5-ium, 3,7-bis (dimethylamino),
Formula: C16H18N3S+
Class: Industrial Chemicals
Methylene blue mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 190 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2015 9:42:20 AM |
| InChI | InChI=1S/C16H18N3S/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13/h5-10H,1-4H3/q+1 |
| InChI Key | RBTBFTRPCNLSDE-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2 |
| CAS | 61734 |
| Splash | |
| Other Names |
Methanaminium, N-[7-(dimethylamino)-3H-phenothiazin-3-ylidene]-N-methyl-; 3,7-Bis(dimethylamino)phenothiazin-5-ium; 3H-Phenothiazine, 7-(dimethylamino)-3-(methylimino), 3-methochloride; Phenothiazin-5-ium, 3,7-bis (dimethylamino), |
| PubChem | 4139 |
| ChEBI | CHEBI:43830 |
| ChemSpider | 3996 |
| ChEMBL | CHEMBL191083 |
| Wikipedia | Methylene blue |