Systematic / IUPAC Name: 2-Acetamido-3-(1H-indol-3-yl)propanoic acid
ID: Reference814
Other Names:
N-Acetyltryptophan;
DL-Tryptophan, N-acetyl-;
Tryptophan, N-acetyl, DL-;
(S)-N-Acetyltryptophan
Formula: C13H14N2O3
Class: Endogenous Metabolites
N-Acetyl-DL-tryptophan mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 191 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2015 2:32:43 PM |
| InChI | InChI=1S/C13H14N2O3/c1-8(16)15-12(13(17)18)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,15,16)(H,17,18) |
| InChI Key | DZTHIGRZJZPRDV-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)O |
| CAS | 1218344 |
| Splash | |
| Other Names |
N-Acetyltryptophan; DL-Tryptophan, N-acetyl-; Tryptophan, N-acetyl, DL-; (S)-N-Acetyltryptophan |
| ChemIDPlus | 001218344; 000087321; 002280015; 062307748 |
| ChemSpider | 1925 |
| ChEMBL | CHEMBL1905494 |
| ChEBI | CHEBI:70976 |
| PubChem | 2002 |