Systematic / IUPAC Name: (5S)-1,7-Bis(3,4-dihydroxyphenyl)-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyheptan-3-one
ID: Reference8201
Other Names:
3-Heptanone, 1,7-bis(3,4-dihydroxyphenyl)-5-(β-D-xylopyranosyloxy)-, (5S)-;
(3S)-1,7-Bis(3,4-dihydroxyphenyl)-5-oxo-3-heptanyl β-D-xylopyranoside
Formula: C24H30O10
Oregonin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 155 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/11/2018 10:52:09 AM |
| InChI | InChI=1S/C24H30O10/c25-15(5-1-13-3-7-17(26)19(28)9-13)11-16(6-2-14-4-8-18(27)20(29)10-14)34-24-23(32)22(31)21(30)12-33-24/h3-4,7-10,16,21-24,26-32H,1-2,5-6,11-12H2/t16-,21+,22-,23+,24-/m0/s1 |
| InChI Key | AQRNEKDRSXYJIN-IRFILORWSA-N |
| Canonical SMILES | C1C(C(C(C(O1)OC(CCC2=CC(=C(C=C2)O)O)CC(=O)CCC3=CC(=C(C=C3)O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names |
3-Heptanone, 1,7-bis(3,4-dihydroxyphenyl)-5-(β-D-xylopyranosyloxy)-, (5S)-; (3S)-1,7-Bis(3,4-dihydroxyphenyl)-5-oxo-3-heptanyl β-D-xylopyranoside |
| ChemSpider | 22913739 |
| ChEMBL | CHEMBL464570 |
| PubChem | 14707658 |