Systematic / IUPAC Name: [(1S,3R,13S,14S,17S,18R,19R,20S,21S,23R,24R,25S)-18,19,21,24-tetrakis(acetyloxy)-25-hydroxy-3,13,14,25-tetramethyl-6,15,22-trioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.0¹,²°.0³,²³.07,¹²]pentacosa-7(12),8,10-trien-20-yl]methyl acetate
ID: Reference8214
Other Names:
Formula: C36H43NO17
Evonine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 4 |
| No. of Spectra | 5564 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/27/2018 6:42:08 AM |
| InChI | InChI=1S/C36H43NO17/c1-15-16(2)31(44)53-29-26(49-18(4)39)30(52-21(7)42)35(14-47-17(3)38)28(51-20(6)41)25(43)23-27(50-19(5)40)36(35,34(29,9)46)54-33(23,8)13-48-32(45)22-11-10-12-37-24(15)22/h10-12,15-16,23,26-30,46H,13-14H2,1-9H3/t15-,16-,23+,26-,27+,28+,29-,30-,33-,34-,35+,36-/m0/s1 |
| InChI Key | IMIAGCONYJPMDY-DYYRVMIMSA-N |
| Canonical SMILES | CC1C(C(=O)OC2C(C(C3(C(C(=O)C4C(C3(C2(C)O)OC4(COC(=O)C5=C1N=CC=C5)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C |
| CAS | |
| Splash | |
| Other Names |