Systematic / IUPAC Name: Alanine
ID: Reference826
Other Names:
2-Aminopropanoic acid;
DL-2-Aminopropionic acid;
DL-2-Aminopropanoic acid;
DL-α-Aminopropionic acid;
Propanoic acid, 2-amino-
; more
Formula: C3H7NO2
Class: Endogenous Metabolites
DL-Alanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 205 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/13/2015 10:10:19 AM |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
| InChI Key | QNAYBMKLOCPYGJ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)O)N |
| CAS | 302727 |
| Splash | |
| Other Names |
2-Aminopropanoic acid; DL-2-Aminopropionic acid; DL-2-Aminopropanoic acid; DL-α-Aminopropionic acid; Propanoic acid, 2-amino-; α-Aminopropionic acid; DL-α-Alanine; Alanine, DL- |
| Wikipedia | Alanine |
| ChemIDPlus | 006898948; 000302727; 115586226 |
| KEGG | C01401 |
| ChEMBL | CHEMBL12198 |
| ChEBI | CHEBI:16449; CHEBI:66916 |
| PubChem | 602 |
| ChemSpider | 582 |