Systematic / IUPAC Name: (1R,3R,7R,10R,11R,14S,23R,24S,26R,31S,32S,33R,34R,35R)-11,23,24,35-Tetramethyl-16-methylene-29-vinyl-37,38,39,40,41-pentaoxa-21-azaoctacyclo[30.4.1.11,33 13,7 17,10 110,14 020,26 026,31]hentetraconta-20,29-diene-11,34-diol
ID: Reference8275
Other Names:
Formula: C42H63NO7
Class: Natural Toxins
Pinnatoxin G mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 938 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/25/2018 10:24:26 AM |
| InChI | InChI=1S/C42H63NO7/c1-7-30-13-17-39-22-27(3)29(5)25-43-34(39)12-8-10-26(2)20-31-14-16-38(6,45)42(47-31)19-18-40(50-42)15-9-11-32(46-40)24-41-23-28(4)35(44)37(49-41)36(48-41)33(39)21-30/h7,21,27-29,31-33,35-37,44-45H,1-2,8-20,22-25H2,3-6H3/t27-,28+,29-,31-,32+,33+,35+,36-,37+,38+,39+,40+,41+,42+/m0/s1 |
| InChI Key | HHJLLPFQZCUZAJ-HZOPFIBCSA-N |
| Canonical SMILES | CC1CC23CCC(=CC2C4C5C(C(CC(O4)(O5)CC6CCCC7(O6)CCC8(O7)C(CCC(O8)CC(=C)CCCC3=NCC1C)(C)O)C)O)C=C |
| CAS | |
| Splash | |
| Other Names |
| ChemSpider | 27024752 |
| PubChem | 46222658 |
| Wikipedia | Pinnatoxin |