Systematic / IUPAC Name: 2-Amino-6-(1,2-dihydroxypropyl)-7,8-dihydro-4(1H)-pteridinone
ID: Reference828
Other Names: L-Erythro-1-(2-amino-7,8-dihydro-4-hydroxy-6-pteridinyl)-1,2-propanediol
Formula: C9H13N5O3
7,8-Dihydrobiopterin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 446 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/13/2015 1:42:19 PM |
| InChI | InChI=1S/C9H13N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3,6,15-16H,2H2,1H3,(H4,10,11,13,14,17) |
| InChI Key | FEMXZDUTFRTWPE-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(C1=NC2=C(NC1)NC(=NC2=O)N)O)O |
| CAS | 6779879 |
| Splash | |
| Other Names | L-Erythro-1-(2-amino-7,8-dihydro-4-hydroxy-6-pteridinyl)-1,2-propanediol |
| PubChem | 252 |
| ChemSpider | 247 |
| HMDb | HMDB00038 |
| ChEBI | CHEBI:64277 |
| KEGG | C02953 |